C17H26N4O3S — CID 113071369
1-cyclopropyl-3-[2-(N-methylsulfonyl-4-pyrrolidin-1-ylanilino)ethyl]urea (PubChem CID 113071369) has the molecular formula C17H26N4O3S and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-(N-methylsulfonyl-4-pyrrolidin-1-ylanilino)ethyl]urea.
| Compound Name | 1-cyclopropyl-3-[2-(N-methylsulfonyl-4-pyrrolidin-1-ylanilino)ethyl]urea |
|---|---|
| PubChem CID | 113071369 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-cyclopropyl-3-[2-(N-methylsulfonyl-4-pyrrolidin-1-ylanilino)ethyl]urea |
| SMILES | CS(=O)(=O)N(CCNC(=O)NC1CC1)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C17H26N4O3S/c1-25(23,24)21(13-10-18-17(22)19-14-4-5-14)16-8-6-15(7-9-16)20-11-2-3-12-20/h6-9,14H,2-5,10-13H2,1H3,(H2,18,19,22) |
| InChIKey | ZVNRNPNPMYISTF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|