C16H26N4O4S — CID 113071434
methyl N-[2-[4-(4-methylpiperazin-1-yl)-N-methylsulfonylanilino]ethyl]carbamate (PubChem CID 113071434) has the molecular formula C16H26N4O4S and a molecular weight of 370.48 g/mol. Its IUPAC name is methyl N-[2-[4-(4-methylpiperazin-1-yl)-N-methylsulfonylanilino]ethyl]carbamate.
| Compound Name | methyl N-[2-[4-(4-methylpiperazin-1-yl)-N-methylsulfonylanilino]ethyl]carbamate |
|---|---|
| PubChem CID | 113071434 |
| Molecular Formula | C16H26N4O4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | methyl N-[2-[4-(4-methylpiperazin-1-yl)-N-methylsulfonylanilino]ethyl]carbamate |
| SMILES | COC(=O)NCCN(c1ccc(N2CCN(C)CC2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C16H26N4O4S/c1-18-10-12-19(13-11-18)14-4-6-15(7-5-14)20(25(3,22)23)9-8-17-16(21)24-2/h4-7H,8-13H2,1-3H3,(H,17,21) |
| InChIKey | BORYMYUDMVKFDG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|