C18H25N3O3S — CID 113146748
3-(2-cyano-N-methylsulfonylanilino)-N-cycloheptylpropanamide (PubChem CID 113146748) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 3-(2-cyano-N-methylsulfonylanilino)-N-cycloheptylpropanamide.
| Compound Name | 3-(2-cyano-N-methylsulfonylanilino)-N-cycloheptylpropanamide |
|---|---|
| PubChem CID | 113146748 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-(2-cyano-N-methylsulfonylanilino)-N-cycloheptylpropanamide |
| SMILES | CS(=O)(=O)N(CCC(=O)NC1CCCCCC1)c1ccccc1C#N |
| InChI | InChI=1S/C18H25N3O3S/c1-25(23,24)21(17-11-7-6-8-15(17)14-19)13-12-18(22)20-16-9-4-2-3-5-10-16/h6-8,11,16H,2-5,9-10,12-13H2,1H3,(H,20,22) |
| InChIKey | DDRZFYWGYBMPAX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |