C17H14F3N3O3S — CID 113072191
N-[2-(2-cyano-N-methylsulfonylanilino)ethyl]-2,3,4-trifluorobenzamide (PubChem CID 113072191) has the molecular formula C17H14F3N3O3S and a molecular weight of 397.38 g/mol. Its IUPAC name is N-[2-(2-cyano-N-methylsulfonylanilino)ethyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[2-(2-cyano-N-methylsulfonylanilino)ethyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 113072191 |
| Molecular Formula | C17H14F3N3O3S |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-[2-(2-cyano-N-methylsulfonylanilino)ethyl]-2,3,4-trifluorobenzamide |
| SMILES | CS(=O)(=O)N(CCNC(=O)c1ccc(F)c(F)c1F)c1ccccc1C#N |
| InChI | InChI=1S/C17H14F3N3O3S/c1-27(25,26)23(14-5-3-2-4-11(14)10-21)9-8-22-17(24)12-6-7-13(18)16(20)15(12)19/h2-7H,8-9H2,1H3,(H,22,24) |
| InChIKey | WOJPPTRJLYSTBB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|