C9H8Cl2N2O2S — CID 20524760
N-(cyanomethyl)-N-(3,4-dichlorophenyl)methanesulfonamide (PubChem CID 20524760) has the molecular formula C9H8Cl2N2O2S and a molecular weight of 279.15 g/mol. Its IUPAC name is N-(cyanomethyl)-N-(3,4-dichlorophenyl)methanesulfonamide.
| Compound Name | N-(cyanomethyl)-N-(3,4-dichlorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 20524760 |
| Molecular Formula | C9H8Cl2N2O2S |
| Molecular Weight | 279.15 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | N-(cyanomethyl)-N-(3,4-dichlorophenyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(CC#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2N2O2S/c1-16(14,15)13(5-4-12)7-2-3-8(10)9(11)6-7/h2-3,6H,5H2,1H3 |
| InChIKey | VHFSGMGDYIUTDX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|