C10H11Cl2NO3S — CID 124927747
N-(3,4-dichlorophenyl)-N-methylsulfonylpropanamide (PubChem CID 124927747) has the molecular formula C10H11Cl2NO3S and a molecular weight of 296.18 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N-methylsulfonylpropanamide.
| Compound Name | N-(3,4-dichlorophenyl)-N-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 124927747 |
| Molecular Formula | C10H11Cl2NO3S |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N-methylsulfonylpropanamide |
| SMILES | CCC(=O)N(c1ccc(Cl)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C10H11Cl2NO3S/c1-3-10(14)13(17(2,15)16)7-4-5-8(11)9(12)6-7/h4-6H,3H2,1-2H3 |
| InChIKey | SROMKJMBFXLCAO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |