C8H3Cl4NO2 — CID 21400337
N-carbonochloridoyl-N-(3,4-dichlorophenyl)carbamoyl chloride (PubChem CID 21400337) has the molecular formula C8H3Cl4NO2 and a molecular weight of 286.93 g/mol. Its IUPAC name is N-carbonochloridoyl-N-(3,4-dichlorophenyl)carbamoyl chloride.
| Compound Name | N-carbonochloridoyl-N-(3,4-dichlorophenyl)carbamoyl chloride |
|---|---|
| PubChem CID | 21400337 |
| Molecular Formula | C8H3Cl4NO2 |
| Molecular Weight | 286.93 g/mol |
| Exact Mass | 284.89 |
| IUPAC Name | N-carbonochloridoyl-N-(3,4-dichlorophenyl)carbamoyl chloride |
| SMILES | O=C(Cl)N(C(=O)Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H3Cl4NO2/c9-5-2-1-4(3-6(5)10)13(7(11)14)8(12)15/h1-3H |
| InChIKey | FSOGQKBUFKBUOH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.93 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|