C11H5Cl4N3O — CID 178189914
N-(6-chloropyrimidin-4-yl)-N-(3,4-dichlorophenyl)carbamoyl chloride (PubChem CID 178189914) has the molecular formula C11H5Cl4N3O and a molecular weight of 336.99 g/mol. Its IUPAC name is N-(6-chloropyrimidin-4-yl)-N-(3,4-dichlorophenyl)carbamoyl chloride.
| Compound Name | N-(6-chloropyrimidin-4-yl)-N-(3,4-dichlorophenyl)carbamoyl chloride |
|---|---|
| PubChem CID | 178189914 |
| Molecular Formula | C11H5Cl4N3O |
| Molecular Weight | 336.99 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | N-(6-chloropyrimidin-4-yl)-N-(3,4-dichlorophenyl)carbamoyl chloride |
| SMILES | O=C(Cl)N(c1ccc(Cl)c(Cl)c1)c1cc(Cl)ncn1 |
| InChI | InChI=1S/C11H5Cl4N3O/c12-7-2-1-6(3-8(7)13)18(11(15)19)10-4-9(14)16-5-17-10/h1-5H |
| InChIKey | LPOJRKUOKDBHJQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.99 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|