C18H16ClN3 — CID 130157763
N,N-dibenzyl-6-chloropyrimidin-4-amine (PubChem CID 130157763) has the molecular formula C18H16ClN3 and a molecular weight of 309.80 g/mol. Its IUPAC name is N,N-dibenzyl-6-chloropyrimidin-4-amine.
| Compound Name | N,N-dibenzyl-6-chloropyrimidin-4-amine |
|---|---|
| PubChem CID | 130157763 |
| Molecular Formula | C18H16ClN3 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N,N-dibenzyl-6-chloropyrimidin-4-amine |
| SMILES | Clc1cc(N(Cc2ccccc2)Cc2ccccc2)ncn1 |
| InChI | InChI=1S/C18H16ClN3/c19-17-11-18(21-14-20-17)22(12-15-7-3-1-4-8-15)13-16-9-5-2-6-10-16/h1-11,14H,12-13H2 |
| InChIKey | HGGKFJYDRBSCHR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |