C19H17ClN2 — CID 130159096
N,N-dibenzyl-6-chloropyridin-2-amine (PubChem CID 130159096) has the molecular formula C19H17ClN2 and a molecular weight of 308.81 g/mol. Its IUPAC name is N,N-dibenzyl-6-chloropyridin-2-amine.
| Compound Name | N,N-dibenzyl-6-chloropyridin-2-amine |
|---|---|
| PubChem CID | 130159096 |
| Molecular Formula | C19H17ClN2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N,N-dibenzyl-6-chloropyridin-2-amine |
| SMILES | Clc1cccc(N(Cc2ccccc2)Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H17ClN2/c20-18-12-7-13-19(21-18)22(14-16-8-3-1-4-9-16)15-17-10-5-2-6-11-17/h1-13H,14-15H2 |
| InChIKey | UIPYRFFVSHGFSP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|