C8H6Cl2N2O2 — CID 172861068
(3,4-dichlorophenyl)-(methylideneamino)carbamic acid (PubChem CID 172861068) has the molecular formula C8H6Cl2N2O2 and a molecular weight of 233.05 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(methylideneamino)carbamic acid.
| Compound Name | (3,4-dichlorophenyl)-(methylideneamino)carbamic acid |
|---|---|
| PubChem CID | 172861068 |
| Molecular Formula | C8H6Cl2N2O2 |
| Molecular Weight | 233.05 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | (3,4-dichlorophenyl)-(methylideneamino)carbamic acid |
| SMILES | C=NN(C(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H6Cl2N2O2/c1-11-12(8(13)14)5-2-3-6(9)7(10)4-5/h2-4H,1H2,(H,13,14) |
| InChIKey | ZJAJXENAYKBLBX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.05 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|