C9H5Cl5NO2- — CID 57354545
N-(3,4-dichlorophenyl)-N-(2,2,2-trichloroethyl)carbamate (PubChem CID 57354545) has the molecular formula C9H5Cl5NO2- and a molecular weight of 336.41 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N-(2,2,2-trichloroethyl)carbamate.
| Compound Name | N-(3,4-dichlorophenyl)-N-(2,2,2-trichloroethyl)carbamate |
|---|---|
| PubChem CID | 57354545 |
| Molecular Formula | C9H5Cl5NO2- |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 333.88 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N-(2,2,2-trichloroethyl)carbamate |
| SMILES | O=C([O-])N(CC(Cl)(Cl)Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H6Cl5NO2/c10-6-2-1-5(3-7(6)11)15(8(16)17)4-9(12,13)14/h1-3H,4H2,(H,16,17)/p-1 |
| InChIKey | BVRLWYZZLQOOON-UHFFFAOYSA-M |
| XLogP | 3.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|