C10H11Cl2NS2 — CID 172922141
(3,4-dichlorophenyl)-propylcarbamodithioic acid (PubChem CID 172922141) has the molecular formula C10H11Cl2NS2 and a molecular weight of 280.25 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-propylcarbamodithioic acid.
| Compound Name | (3,4-dichlorophenyl)-propylcarbamodithioic acid |
|---|---|
| PubChem CID | 172922141 |
| Molecular Formula | C10H11Cl2NS2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | (3,4-dichlorophenyl)-propylcarbamodithioic acid |
| SMILES | CCCN(C(=S)S)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NS2/c1-2-5-13(10(14)15)7-3-4-8(11)9(12)6-7/h3-4,6H,2,5H2,1H3,(H,14,15) |
| InChIKey | IPGMXWMGEXJRAK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|