methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate

C11H11Cl2NS2 — CID 71423378

IUPACmethyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate
SMILESC=CCN(C(=S)SC)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C11H11Cl2NS2/c1-3-6-14(11(15)16-2)8-4-5-9(12)10(13)7-8/h3-5,7H,1,6H2,2H3
InChIKeyCOPPWEVMJHEHJV-UHFFFAOYSA-N
MW292.26 g/mol
LogP4.63
Rot. Bonds3

About methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate

methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate (PubChem CID 71423378) has the molecular formula C11H11Cl2NS2 and a molecular weight of 292.26 g/mol. Its IUPAC name is methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate.

Molecular Properties

Compound Namemethyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate
PubChem CID71423378
Molecular FormulaC11H11Cl2NS2
Molecular Weight292.26 g/mol
Exact Mass290.97
IUPAC Namemethyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate
SMILESC=CCN(C(=S)SC)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C11H11Cl2NS2/c1-3-6-14(11(15)16-2)8-4-5-9(12)10(13)7-8/h3-5,7H,1,6H2,2H3
InChIKeyCOPPWEVMJHEHJV-UHFFFAOYSA-N
XLogP4.63
TPSA3.24 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.26
LogP ≤ 54.63
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate?
The IUPAC name of methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate (CID 71423378) is methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate.
What is the SMILES notation for methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate?
The canonical SMILES for methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate is C=CCN(C(=S)SC)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate?
The InChIKey is COPPWEVMJHEHJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2NS2/c1-3-6-14(11(15)16-2)8-4-5-9(12)10(13)7-8/h3-5,7H,1,6H2,2H3.
What are the key properties of methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate?
methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate has a molecular weight of 292.26 g/mol, XLogP of 4.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate is sourced from PubChem (CID 71423378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).