C11H11Cl2NS2 — CID 71423378
methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate (PubChem CID 71423378) has the molecular formula C11H11Cl2NS2 and a molecular weight of 292.26 g/mol. Its IUPAC name is methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate.
| Compound Name | methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate |
|---|---|
| PubChem CID | 71423378 |
| Molecular Formula | C11H11Cl2NS2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | methyl N-(3,4-dichlorophenyl)-N-prop-2-enylcarbamodithioate |
| SMILES | C=CCN(C(=S)SC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NS2/c1-3-6-14(11(15)16-2)8-4-5-9(12)10(13)7-8/h3-5,7H,1,6H2,2H3 |
| InChIKey | COPPWEVMJHEHJV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|