C16H20Cl2N2S — CID 3820708
1-cyclohexyl-3-(3,4-dichlorophenyl)-1-prop-2-enylthiourea (PubChem CID 3820708) has the molecular formula C16H20Cl2N2S and a molecular weight of 343.32 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,4-dichlorophenyl)-1-prop-2-enylthiourea.
| Compound Name | 1-cyclohexyl-3-(3,4-dichlorophenyl)-1-prop-2-enylthiourea |
|---|---|
| PubChem CID | 3820708 |
| Molecular Formula | C16H20Cl2N2S |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-cyclohexyl-3-(3,4-dichlorophenyl)-1-prop-2-enylthiourea |
| SMILES | C=CCN(C(=S)Nc1ccc(Cl)c(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C16H20Cl2N2S/c1-2-10-20(13-6-4-3-5-7-13)16(21)19-12-8-9-14(17)15(18)11-12/h2,8-9,11,13H,1,3-7,10H2,(H,19,21) |
| InChIKey | QNSGNZPBEWSMPG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|