C17H21ClN2OS — CID 3809645
2-chloro-N-[cyclohexyl(prop-2-enyl)carbamothioyl]benzamide (PubChem CID 3809645) has the molecular formula C17H21ClN2OS and a molecular weight of 336.89 g/mol. Its IUPAC name is 2-chloro-N-[cyclohexyl(prop-2-enyl)carbamothioyl]benzamide.
| Compound Name | 2-chloro-N-[cyclohexyl(prop-2-enyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3809645 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-chloro-N-[cyclohexyl(prop-2-enyl)carbamothioyl]benzamide |
| SMILES | C=CCN(C(=S)NC(=O)c1ccccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C17H21ClN2OS/c1-2-12-20(13-8-4-3-5-9-13)17(22)19-16(21)14-10-6-7-11-15(14)18/h2,6-7,10-11,13H,1,3-5,8-9,12H2,(H,19,21,22) |
| InChIKey | RNYDPCCUFJSFQY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|