C16H20Cl2N2O — CID 3833190
1-cyclohexyl-3-(2,3-dichlorophenyl)-1-prop-2-enylurea (PubChem CID 3833190) has the molecular formula C16H20Cl2N2O and a molecular weight of 327.25 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,3-dichlorophenyl)-1-prop-2-enylurea.
| Compound Name | 1-cyclohexyl-3-(2,3-dichlorophenyl)-1-prop-2-enylurea |
|---|---|
| PubChem CID | 3833190 |
| Molecular Formula | C16H20Cl2N2O |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1-cyclohexyl-3-(2,3-dichlorophenyl)-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)Nc1cccc(Cl)c1Cl)C1CCCCC1 |
| InChI | InChI=1S/C16H20Cl2N2O/c1-2-11-20(12-7-4-3-5-8-12)16(21)19-14-10-6-9-13(17)15(14)18/h2,6,9-10,12H,1,3-5,7-8,11H2,(H,19,21) |
| InChIKey | HMFFRULZDVZDPR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|