C16H17Cl2N3O — CID 42760129
3-(2,3-dichlorophenyl)-1-[(1-methylpyrrol-2-yl)methyl]-1-prop-2-enylurea (PubChem CID 42760129) has the molecular formula C16H17Cl2N3O and a molecular weight of 338.24 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1-[(1-methylpyrrol-2-yl)methyl]-1-prop-2-enylurea.
| Compound Name | 3-(2,3-dichlorophenyl)-1-[(1-methylpyrrol-2-yl)methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 42760129 |
| Molecular Formula | C16H17Cl2N3O |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1-[(1-methylpyrrol-2-yl)methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1cccn1C)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H17Cl2N3O/c1-3-9-21(11-12-6-5-10-20(12)2)16(22)19-14-8-4-7-13(17)15(14)18/h3-8,10H,1,9,11H2,2H3,(H,19,22) |
| InChIKey | FVPCDXUWWACMJD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|