C16H16Cl2N4O3 — CID 4183757
2-[(2,3-dichlorophenyl)carbamoyl-prop-2-enylamino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 4183757) has the molecular formula C16H16Cl2N4O3 and a molecular weight of 383.24 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)carbamoyl-prop-2-enylamino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[(2,3-dichlorophenyl)carbamoyl-prop-2-enylamino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 4183757 |
| Molecular Formula | C16H16Cl2N4O3 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)carbamoyl-prop-2-enylamino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | C=CCN(CC(=O)Nc1cc(C)on1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H16Cl2N4O3/c1-3-7-22(9-14(23)20-13-8-10(2)25-21-13)16(24)19-12-6-4-5-11(17)15(12)18/h3-6,8H,1,7,9H2,2H3,(H,19,24)(H,20,21,23) |
| InChIKey | VLAKPWGRACQSDE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|