C11H13Cl2N3O3 — CID 42770232
2,2-dichloro-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-N-prop-2-enylacetamide (PubChem CID 42770232) has the molecular formula C11H13Cl2N3O3 and a molecular weight of 306.15 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-N-prop-2-enylacetamide.
| Compound Name | 2,2-dichloro-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 42770232 |
| Molecular Formula | C11H13Cl2N3O3 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2,2-dichloro-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(CC(=O)Nc1cc(C)on1)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C11H13Cl2N3O3/c1-3-4-16(11(18)10(12)13)6-9(17)14-8-5-7(2)19-15-8/h3,5,10H,1,4,6H2,2H3,(H,14,15,17) |
| InChIKey | IINVGUJDLWLUKZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|