C18H16F6N4O3 — CID 42770429
2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-prop-2-enylamino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 42770429) has the molecular formula C18H16F6N4O3 and a molecular weight of 450.34 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-prop-2-enylamino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-prop-2-enylamino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 42770429 |
| Molecular Formula | C18H16F6N4O3 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-prop-2-enylamino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | C=CCN(CC(=O)Nc1cc(C)on1)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F6N4O3/c1-3-4-28(9-15(29)26-14-5-10(2)31-27-14)16(30)25-13-7-11(17(19,20)21)6-12(8-13)18(22,23)24/h3,5-8H,1,4,9H2,2H3,(H,25,30)(H,26,27,29) |
| InChIKey | TWLWAAOTMPKACL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|