C19H20Cl2N2OS — CID 58924904
N-cyclohexyl-2-(2,3-dichlorophenyl)-N-prop-2-enyl-1,3-thiazole-4-carboxamide (PubChem CID 58924904) has the molecular formula C19H20Cl2N2OS and a molecular weight of 395.36 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,3-dichlorophenyl)-N-prop-2-enyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-cyclohexyl-2-(2,3-dichlorophenyl)-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 58924904 |
| Molecular Formula | C19H20Cl2N2OS |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | N-cyclohexyl-2-(2,3-dichlorophenyl)-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
| SMILES | C=CCN(C(=O)c1csc(-c2cccc(Cl)c2Cl)n1)C1CCCCC1 |
| InChI | InChI=1S/C19H20Cl2N2OS/c1-2-11-23(13-7-4-3-5-8-13)19(24)16-12-25-18(22-16)14-9-6-10-15(20)17(14)21/h2,6,9-10,12-13H,1,3-5,7-8,11H2 |
| InChIKey | QSDUJERVFSBYGM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|