C16H14Cl2N2O2S — CID 58924942
1-[2-(2,3-dichlorophenyl)-1,3-thiazole-4-carbonyl]azepan-4-one (PubChem CID 58924942) has the molecular formula C16H14Cl2N2O2S and a molecular weight of 369.27 g/mol. Its IUPAC name is 1-[2-(2,3-dichlorophenyl)-1,3-thiazole-4-carbonyl]azepan-4-one.
| Compound Name | 1-[2-(2,3-dichlorophenyl)-1,3-thiazole-4-carbonyl]azepan-4-one |
|---|---|
| PubChem CID | 58924942 |
| Molecular Formula | C16H14Cl2N2O2S |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 1-[2-(2,3-dichlorophenyl)-1,3-thiazole-4-carbonyl]azepan-4-one |
| SMILES | O=C1CCCN(C(=O)c2csc(-c3cccc(Cl)c3Cl)n2)CC1 |
| InChI | InChI=1S/C16H14Cl2N2O2S/c17-12-5-1-4-11(14(12)18)15-19-13(9-23-15)16(22)20-7-2-3-10(21)6-8-20/h1,4-5,9H,2-3,6-8H2 |
| InChIKey | KRLLFGAPELNKHG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |