C20H20ClN3O3S2 — CID 1015661
N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-2-chlorobenzamide (PubChem CID 1015661) has the molecular formula C20H20ClN3O3S2 and a molecular weight of 449.99 g/mol. Its IUPAC name is N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-2-chlorobenzamide.
| Compound Name | N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 1015661 |
| Molecular Formula | C20H20ClN3O3S2 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-2-chlorobenzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H20ClN3O3S2/c1-3-13-24(14-4-2)29(26,27)16-11-9-15(10-12-16)22-20(28)23-19(25)17-7-5-6-8-18(17)21/h3-12H,1-2,13-14H2,(H2,22,23,25,28) |
| InChIKey | NPSKIJOXPCJZSN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|