C21H22ClN3O3S2 — CID 4936993
N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide (PubChem CID 4936993) has the molecular formula C21H22ClN3O3S2 and a molecular weight of 464.01 g/mol. Its IUPAC name is N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 4936993 |
| Molecular Formula | C21H22ClN3O3S2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=S)NC(=O)Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H22ClN3O3S2/c1-3-13-25(14-4-2)30(27,28)19-11-9-18(10-12-19)23-21(29)24-20(26)15-16-5-7-17(22)8-6-16/h3-12H,1-2,13-15H2,(H2,23,24,26,29) |
| InChIKey | QSTFHZZZFFLVHI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|