C17H18ClN3O3S2 — CID 4924612
2-chloro-N-[[4-(propan-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 4924612) has the molecular formula C17H18ClN3O3S2 and a molecular weight of 411.94 g/mol. Its IUPAC name is 2-chloro-N-[[4-(propan-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-chloro-N-[[4-(propan-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4924612 |
| Molecular Formula | C17H18ClN3O3S2 |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 2-chloro-N-[[4-(propan-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H18ClN3O3S2/c1-11(2)21-26(23,24)13-9-7-12(8-10-13)19-17(25)20-16(22)14-5-3-4-6-15(14)18/h3-11,21H,1-2H3,(H2,19,20,22,25) |
| InChIKey | RXRXXCMUBRWXBU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|