C18H18Cl2N2O3S — CID 7687450
N-[4-[(2,6-dichlorophenyl)methyl-prop-2-enylsulfamoyl]phenyl]acetamide (PubChem CID 7687450) has the molecular formula C18H18Cl2N2O3S and a molecular weight of 413.33 g/mol. Its IUPAC name is N-[4-[(2,6-dichlorophenyl)methyl-prop-2-enylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(2,6-dichlorophenyl)methyl-prop-2-enylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 7687450 |
| Molecular Formula | C18H18Cl2N2O3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | N-[4-[(2,6-dichlorophenyl)methyl-prop-2-enylsulfamoyl]phenyl]acetamide |
| SMILES | C=CCN(Cc1c(Cl)cccc1Cl)S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O3S/c1-3-11-22(12-16-17(19)5-4-6-18(16)20)26(24,25)15-9-7-14(8-10-15)21-13(2)23/h3-10H,1,11-12H2,2H3,(H,21,23) |
| InChIKey | PWUCTRUIQFBFHO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|