C16H14Cl2N2O — CID 20787917
3-(3,4-dichlorophenyl)-1-phenyl-1-prop-2-enylurea (PubChem CID 20787917) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-phenyl-1-prop-2-enylurea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-phenyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 20787917 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-phenyl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)Nc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C16H14Cl2N2O/c1-2-10-20(13-6-4-3-5-7-13)16(21)19-12-8-9-14(17)15(18)11-12/h2-9,11H,1,10H2,(H,19,21) |
| InChIKey | RXZXZVTULCNEFL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|