C20H16Cl2N2O2 — CID 12589377
3-(3,4-dichlorophenyl)-1-phenyl-1-phenylmethoxyurea (PubChem CID 12589377) has the molecular formula C20H16Cl2N2O2 and a molecular weight of 387.27 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-phenyl-1-phenylmethoxyurea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-phenyl-1-phenylmethoxyurea |
|---|---|
| PubChem CID | 12589377 |
| Molecular Formula | C20H16Cl2N2O2 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-phenyl-1-phenylmethoxyurea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N(OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16Cl2N2O2/c21-18-12-11-16(13-19(18)22)23-20(25)24(17-9-5-2-6-10-17)26-14-15-7-3-1-4-8-15/h1-13H,14H2,(H,23,25) |
| InChIKey | BBJWNCKBDWQMLA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|