C18H12Cl2N2O4S — CID 57288321
[4-[(3,4-dichlorophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate (PubChem CID 57288321) has the molecular formula C18H12Cl2N2O4S and a molecular weight of 423.28 g/mol. Its IUPAC name is [4-[(3,4-dichlorophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate.
| Compound Name | [4-[(3,4-dichlorophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 57288321 |
| Molecular Formula | C18H12Cl2N2O4S |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | [4-[(3,4-dichlorophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1ccc(N(S)C(=O)Nc2ccc(Cl)c(Cl)c2)cc1)c1ccco1 |
| InChI | InChI=1S/C18H12Cl2N2O4S/c19-14-8-3-11(10-15(14)20)21-18(24)22(27)12-4-6-13(7-5-12)26-17(23)16-2-1-9-25-16/h1-10,27H,(H,21,24) |
| InChIKey | MYOQFZYPZXFZSM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|