C12H11Cl2N2O+ — CID 8007611
[(3,4-dichloroanilino)-(furan-2-yl)methylidene]-methylazanium (PubChem CID 8007611) has the molecular formula C12H11Cl2N2O+ and a molecular weight of 270.14 g/mol. Its IUPAC name is [(3,4-dichloroanilino)-(furan-2-yl)methylidene]-methylazanium.
| Compound Name | [(3,4-dichloroanilino)-(furan-2-yl)methylidene]-methylazanium |
|---|---|
| PubChem CID | 8007611 |
| Molecular Formula | C12H11Cl2N2O+ |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | [(3,4-dichloroanilino)-(furan-2-yl)methylidene]-methylazanium |
| SMILES | C/[NH+]=C(/Nc1ccc(Cl)c(Cl)c1)c1ccco1 |
| InChI | InChI=1S/C12H10Cl2N2O/c1-15-12(11-3-2-6-17-11)16-8-4-5-9(13)10(14)7-8/h2-7H,1H3,(H,15,16)/p+1 |
| InChIKey | XIKOCTLWHQYXNQ-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 39.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|