About [4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate
[4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate (PubChem CID 57228302) has the molecular formula C18H12ClIN2O4S
and a molecular weight of 514.73 g/mol. Its IUPAC name is [4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate.
Molecular Properties
| Compound Name | [4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate |
| PubChem CID | 57228302 |
| Molecular Formula | C18H12ClIN2O4S |
| Molecular Weight | 514.73 g/mol |
| Exact Mass | 513.93 |
| IUPAC Name | [4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1ccc(N(S)C(=O)Nc2ccc(I)c(Cl)c2)cc1)c1ccco1 |
| InChI | InChI=1S/C18H12ClIN2O4S/c19-14-10-11(3-8-15(14)20)21-18(24)22(27)12-4-6-13(7-5-12)26-17(23)16-2-1-9-25-16/h1-10,27H,(H,21,24) |
| InChIKey | CNAFDCJIBFFIFS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.73 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate?
The IUPAC name of [4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate (CID 57228302) is [4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate.
What is the SMILES notation for [4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate?
The canonical SMILES for [4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate is O=C(Oc1ccc(N(S)C(=O)Nc2ccc(I)c(Cl)c2)cc1)c1ccco1.
What is the InChIKey of [4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate?
The InChIKey is CNAFDCJIBFFIFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClIN2O4S/c19-14-10-11(3-8-15(14)20)21-18(24)22(27)12-4-6-13(7-5-12)26-17(23)16-2-1-9-25-16/h1-10,27H,(H,21,24).
What are the key properties of [4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate?
[4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate has a molecular weight of 514.73 g/mol, XLogP of 5.64, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3-chloro-4-iodophenyl)carbamoyl-sulfanylamino]phenyl] furan-2-carboxylate is sourced from PubChem (CID 57228302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).