C18H15ClN2O5S — CID 3995207
N-[4-chloro-3-[(4-methoxyphenyl)sulfamoyl]phenyl]furan-2-carboxamide (PubChem CID 3995207) has the molecular formula C18H15ClN2O5S and a molecular weight of 406.85 g/mol. Its IUPAC name is N-[4-chloro-3-[(4-methoxyphenyl)sulfamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-chloro-3-[(4-methoxyphenyl)sulfamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3995207 |
| Molecular Formula | C18H15ClN2O5S |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | N-[4-chloro-3-[(4-methoxyphenyl)sulfamoyl]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)c3ccco3)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H15ClN2O5S/c1-25-14-7-4-12(5-8-14)21-27(23,24)17-11-13(6-9-15(17)19)20-18(22)16-3-2-10-26-16/h2-11,21H,1H3,(H,20,22) |
| InChIKey | QZTPSAIJJIQQQL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |