C20H18ClN3O5S — CID 30474795
N-[2-[3-[(4-chlorophenyl)sulfamoyl]-4-methylanilino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 30474795) has the molecular formula C20H18ClN3O5S and a molecular weight of 447.90 g/mol. Its IUPAC name is N-[2-[3-[(4-chlorophenyl)sulfamoyl]-4-methylanilino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[3-[(4-chlorophenyl)sulfamoyl]-4-methylanilino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 30474795 |
| Molecular Formula | C20H18ClN3O5S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | N-[2-[3-[(4-chlorophenyl)sulfamoyl]-4-methylanilino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)CNC(=O)c2ccco2)cc1S(=O)(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClN3O5S/c1-13-4-7-16(23-19(25)12-22-20(26)17-3-2-10-29-17)11-18(13)30(27,28)24-15-8-5-14(21)6-9-15/h2-11,24H,12H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | AHLRAVYKLWOFDJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |