C20H18N2O6S — CID 25335107
methyl 3-[[3-(furan-2-carbonylamino)phenyl]sulfamoyl]-4-methylbenzoate (PubChem CID 25335107) has the molecular formula C20H18N2O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is methyl 3-[[3-(furan-2-carbonylamino)phenyl]sulfamoyl]-4-methylbenzoate.
| Compound Name | methyl 3-[[3-(furan-2-carbonylamino)phenyl]sulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 25335107 |
| Molecular Formula | C20H18N2O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | methyl 3-[[3-(furan-2-carbonylamino)phenyl]sulfamoyl]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(S(=O)(=O)Nc2cccc(NC(=O)c3ccco3)c2)c1 |
| InChI | InChI=1S/C20H18N2O6S/c1-13-8-9-14(20(24)27-2)11-18(13)29(25,26)22-16-6-3-5-15(12-16)21-19(23)17-7-4-10-28-17/h3-12,22H,1-2H3,(H,21,23) |
| InChIKey | HWFJTOOYADHEDL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |