C17H15N3O6S2 — CID 18206661
N-[3-[(4-sulfamoylphenyl)sulfonylamino]phenyl]furan-2-carboxamide (PubChem CID 18206661) has the molecular formula C17H15N3O6S2 and a molecular weight of 421.46 g/mol. Its IUPAC name is N-[3-[(4-sulfamoylphenyl)sulfonylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(4-sulfamoylphenyl)sulfonylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18206661 |
| Molecular Formula | C17H15N3O6S2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | N-[3-[(4-sulfamoylphenyl)sulfonylamino]phenyl]furan-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)Nc2cccc(NC(=O)c3ccco3)c2)cc1 |
| InChI | InChI=1S/C17H15N3O6S2/c18-27(22,23)14-6-8-15(9-7-14)28(24,25)20-13-4-1-3-12(11-13)19-17(21)16-5-2-10-26-16/h1-11,20H,(H,19,21)(H2,18,22,23) |
| InChIKey | BNDNAOIWRCMBNK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 148.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |