C15H12N4O6S — CID 90515186
2-(furan-2-carbonylamino)-N-(4-sulfamoylphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 90515186) has the molecular formula C15H12N4O6S and a molecular weight of 376.35 g/mol. Its IUPAC name is 2-(furan-2-carbonylamino)-N-(4-sulfamoylphenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(furan-2-carbonylamino)-N-(4-sulfamoylphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 90515186 |
| Molecular Formula | C15H12N4O6S |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2-(furan-2-carbonylamino)-N-(4-sulfamoylphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2coc(NC(=O)c3ccco3)n2)cc1 |
| InChI | InChI=1S/C15H12N4O6S/c16-26(22,23)10-5-3-9(4-6-10)17-13(20)11-8-25-15(18-11)19-14(21)12-2-1-7-24-12/h1-8H,(H,17,20)(H2,16,22,23)(H,18,19,21) |
| InChIKey | WFCJECPRJBMRES-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 157.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |