C17H11BrF2N2O4S — CID 25342623
N-[3-[(2-bromo-4,6-difluorophenyl)sulfonylamino]phenyl]furan-2-carboxamide (PubChem CID 25342623) has the molecular formula C17H11BrF2N2O4S and a molecular weight of 457.25 g/mol. Its IUPAC name is N-[3-[(2-bromo-4,6-difluorophenyl)sulfonylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(2-bromo-4,6-difluorophenyl)sulfonylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25342623 |
| Molecular Formula | C17H11BrF2N2O4S |
| Molecular Weight | 457.25 g/mol |
| Exact Mass | 455.96 |
| IUPAC Name | N-[3-[(2-bromo-4,6-difluorophenyl)sulfonylamino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(NS(=O)(=O)c2c(F)cc(F)cc2Br)c1)c1ccco1 |
| InChI | InChI=1S/C17H11BrF2N2O4S/c18-13-7-10(19)8-14(20)16(13)27(24,25)22-12-4-1-3-11(9-12)21-17(23)15-5-2-6-26-15/h1-9,22H,(H,21,23) |
| InChIKey | MHGYUQDMKRJWEL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.25 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |