C14H11BrF2N2O3S — CID 25342673
4-[(2-bromo-4,6-difluorophenyl)sulfonylamino]-N-methylbenzamide (PubChem CID 25342673) has the molecular formula C14H11BrF2N2O3S and a molecular weight of 405.22 g/mol. Its IUPAC name is 4-[(2-bromo-4,6-difluorophenyl)sulfonylamino]-N-methylbenzamide.
| Compound Name | 4-[(2-bromo-4,6-difluorophenyl)sulfonylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 25342673 |
| Molecular Formula | C14H11BrF2N2O3S |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | 4-[(2-bromo-4,6-difluorophenyl)sulfonylamino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NS(=O)(=O)c2c(F)cc(F)cc2Br)cc1 |
| InChI | InChI=1S/C14H11BrF2N2O3S/c1-18-14(20)8-2-4-10(5-3-8)19-23(21,22)13-11(15)6-9(16)7-12(13)17/h2-7,19H,1H3,(H,18,20) |
| InChIKey | TVKRILNLEKFLNU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |