C17H12F2N2O4S — CID 31582051
N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]furan-2-carboxamide (PubChem CID 31582051) has the molecular formula C17H12F2N2O4S and a molecular weight of 378.36 g/mol. Its IUPAC name is N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31582051 |
| Molecular Formula | C17H12F2N2O4S |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1)c1ccco1 |
| InChI | InChI=1S/C17H12F2N2O4S/c18-14-8-7-13(10-15(14)19)26(23,24)21-12-5-3-11(4-6-12)20-17(22)16-2-1-9-25-16/h1-10,21H,(H,20,22) |
| InChIKey | LPFHDKYEHPLKEY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |