C20H15F3N2O3S — CID 51549535
N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-2-(4-fluorophenyl)acetamide (PubChem CID 51549535) has the molecular formula C20H15F3N2O3S and a molecular weight of 420.41 g/mol. Its IUPAC name is N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 51549535 |
| Molecular Formula | C20H15F3N2O3S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)Nc1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H15F3N2O3S/c21-14-3-1-13(2-4-14)11-20(26)24-15-5-7-16(8-6-15)25-29(27,28)17-9-10-18(22)19(23)12-17/h1-10,12,25H,11H2,(H,24,26) |
| InChIKey | MDWNEMTVHWNSTB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |