C20H14F3NO4S — CID 25036611
(4-fluorophenyl)methyl 4-[(3,4-difluorophenyl)sulfonylamino]benzoate (PubChem CID 25036611) has the molecular formula C20H14F3NO4S and a molecular weight of 421.40 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 4-[(3,4-difluorophenyl)sulfonylamino]benzoate.
| Compound Name | (4-fluorophenyl)methyl 4-[(3,4-difluorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 25036611 |
| Molecular Formula | C20H14F3NO4S |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | (4-fluorophenyl)methyl 4-[(3,4-difluorophenyl)sulfonylamino]benzoate |
| SMILES | O=C(OCc1ccc(F)cc1)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H14F3NO4S/c21-15-5-1-13(2-6-15)12-28-20(25)14-3-7-16(8-4-14)24-29(26,27)17-9-10-18(22)19(23)11-17/h1-11,24H,12H2 |
| InChIKey | UBLVLPFMABNZRV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |