C21H16F3N3O5S — CID 25335648
3,4-difluoro-N-[4-[[[2-(4-fluorophenoxy)acetyl]amino]carbamoyl]phenyl]benzenesulfonamide (PubChem CID 25335648) has the molecular formula C21H16F3N3O5S and a molecular weight of 479.44 g/mol. Its IUPAC name is 3,4-difluoro-N-[4-[[[2-(4-fluorophenoxy)acetyl]amino]carbamoyl]phenyl]benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-[4-[[[2-(4-fluorophenoxy)acetyl]amino]carbamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25335648 |
| Molecular Formula | C21H16F3N3O5S |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 3,4-difluoro-N-[4-[[[2-(4-fluorophenoxy)acetyl]amino]carbamoyl]phenyl]benzenesulfonamide |
| SMILES | O=C(COc1ccc(F)cc1)NNC(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C21H16F3N3O5S/c22-14-3-7-16(8-4-14)32-12-20(28)25-26-21(29)13-1-5-15(6-2-13)27-33(30,31)17-9-10-18(23)19(24)11-17/h1-11,27H,12H2,(H,25,28)(H,26,29) |
| InChIKey | IZQNDIMSWPZQDS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|