C19H17F2N3O4S — CID 86900926
3-pyrazol-1-ylpropyl 4-[(3,4-difluorophenyl)sulfonylamino]benzoate (PubChem CID 86900926) has the molecular formula C19H17F2N3O4S and a molecular weight of 421.43 g/mol. Its IUPAC name is 3-pyrazol-1-ylpropyl 4-[(3,4-difluorophenyl)sulfonylamino]benzoate.
| Compound Name | 3-pyrazol-1-ylpropyl 4-[(3,4-difluorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 86900926 |
| Molecular Formula | C19H17F2N3O4S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 3-pyrazol-1-ylpropyl 4-[(3,4-difluorophenyl)sulfonylamino]benzoate |
| SMILES | O=C(OCCCn1cccn1)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H17F2N3O4S/c20-17-8-7-16(13-18(17)21)29(26,27)23-15-5-3-14(4-6-15)19(25)28-12-2-11-24-10-1-9-22-24/h1,3-10,13,23H,2,11-12H2 |
| InChIKey | ZFDHNZJSTJVMMQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|