C23H18F2N4O3S — CID 55719646
N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-4-(imidazol-1-ylmethyl)benzamide (PubChem CID 55719646) has the molecular formula C23H18F2N4O3S and a molecular weight of 468.49 g/mol. Its IUPAC name is N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-4-(imidazol-1-ylmethyl)benzamide.
| Compound Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-4-(imidazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55719646 |
| Molecular Formula | C23H18F2N4O3S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-4-(imidazol-1-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1)c1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C23H18F2N4O3S/c24-21-10-9-20(13-22(21)25)33(31,32)28-19-7-5-18(6-8-19)27-23(30)17-3-1-16(2-4-17)14-29-12-11-26-15-29/h1-13,15,28H,14H2,(H,27,30) |
| InChIKey | LYZCKYGDHXSFPV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |