C20H22F2N2O5S — CID 35143705
butyl 4-[3-[(3,4-difluorophenyl)sulfonylamino]propanoylamino]benzoate (PubChem CID 35143705) has the molecular formula C20H22F2N2O5S and a molecular weight of 440.47 g/mol. Its IUPAC name is butyl 4-[3-[(3,4-difluorophenyl)sulfonylamino]propanoylamino]benzoate.
| Compound Name | butyl 4-[3-[(3,4-difluorophenyl)sulfonylamino]propanoylamino]benzoate |
|---|---|
| PubChem CID | 35143705 |
| Molecular Formula | C20H22F2N2O5S |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | butyl 4-[3-[(3,4-difluorophenyl)sulfonylamino]propanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CCNS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H22F2N2O5S/c1-2-3-12-29-20(26)14-4-6-15(7-5-14)24-19(25)10-11-23-30(27,28)16-8-9-17(21)18(22)13-16/h4-9,13,23H,2-3,10-12H2,1H3,(H,24,25) |
| InChIKey | VCYMMVITJOYMMC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|