C21H25NO5S — CID 2612880
butyl 4-[3-(4-methylphenyl)sulfonylpropanoylamino]benzoate (PubChem CID 2612880) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is butyl 4-[3-(4-methylphenyl)sulfonylpropanoylamino]benzoate.
| Compound Name | butyl 4-[3-(4-methylphenyl)sulfonylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 2612880 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | butyl 4-[3-(4-methylphenyl)sulfonylpropanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CCS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-3-4-14-27-21(24)17-7-9-18(10-8-17)22-20(23)13-15-28(25,26)19-11-5-16(2)6-12-19/h5-12H,3-4,13-15H2,1-2H3,(H,22,23) |
| InChIKey | GTXUYOSZQKEHEA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|