C25H26N2O4S — CID 6195846
butyl 4-[[(Z)-N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]amino]benzoate (PubChem CID 6195846) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is butyl 4-[[(Z)-N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]amino]benzoate.
| Compound Name | butyl 4-[[(Z)-N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]amino]benzoate |
|---|---|
| PubChem CID | 6195846 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | butyl 4-[[(Z)-N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N/C(=N\S(=O)(=O)c2ccc(C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N2O4S/c1-3-4-18-31-25(28)21-12-14-22(15-13-21)26-24(20-8-6-5-7-9-20)27-32(29,30)23-16-10-19(2)11-17-23/h5-17H,3-4,18H2,1-2H3,(H,26,27) |
| InChIKey | IMGRYGFRFPAIPC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|