C28H28N2O5S — CID 16935654
butyl 4-[[2-[3-(4-methylphenyl)sulfonylindol-1-yl]acetyl]amino]benzoate (PubChem CID 16935654) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is butyl 4-[[2-[3-(4-methylphenyl)sulfonylindol-1-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[3-(4-methylphenyl)sulfonylindol-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16935654 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | butyl 4-[[2-[3-(4-methylphenyl)sulfonylindol-1-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)Cn2cc(S(=O)(=O)c3ccc(C)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H28N2O5S/c1-3-4-17-35-28(32)21-11-13-22(14-12-21)29-27(31)19-30-18-26(24-7-5-6-8-25(24)30)36(33,34)23-15-9-20(2)10-16-23/h5-16,18H,3-4,17,19H2,1-2H3,(H,29,31) |
| InChIKey | XTUGBMALFVQZLM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|