C28H27FN2O5S — CID 30560754
butyl 4-[[2-[3-[(4-fluorophenyl)methylsulfonyl]indol-1-yl]acetyl]amino]benzoate (PubChem CID 30560754) has the molecular formula C28H27FN2O5S and a molecular weight of 522.60 g/mol. Its IUPAC name is butyl 4-[[2-[3-[(4-fluorophenyl)methylsulfonyl]indol-1-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[3-[(4-fluorophenyl)methylsulfonyl]indol-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 30560754 |
| Molecular Formula | C28H27FN2O5S |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | butyl 4-[[2-[3-[(4-fluorophenyl)methylsulfonyl]indol-1-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)Cn2cc(S(=O)(=O)Cc3ccc(F)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H27FN2O5S/c1-2-3-16-36-28(33)21-10-14-23(15-11-21)30-27(32)18-31-17-26(24-6-4-5-7-25(24)31)37(34,35)19-20-8-12-22(29)13-9-20/h4-15,17H,2-3,16,18-19H2,1H3,(H,30,32) |
| InChIKey | VKEHEJYWONRLLW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|